| SpectraBase Spectrum ID |
B5MF1cMkPTL |
| Name |
Adenine |
| CAS Registry Number |
73-24-5 |
| Collision Energy |
50 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
135.054495181 u |
| Formula |
C5H5N5 |
| InChI |
InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10) |
| InChIKey |
GFFGJBXGBJISGV-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
135.130 g/mol |
| Nominal Mass |
135 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
136.062 |
| SMILES |
N1C=NC2=NC=NC(=C12)N |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
7H-purin-6-amine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_34.10 |