| SpectraBase Spectrum ID |
B4gkzxl4nP5 |
| Name |
1-(3-Methoxyphenylamino)propan-2-one |
| Appearance |
Yellow oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C10H13NO2 |
| InChI |
InChI=1S/C10H13NO2/c1-8(12)7-11-9-4-3-5-10(6-9)13-2/h3-6,11H,7H2,1-2H3 |
| InChIKey |
UUEQGFLHQKCQAO-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
179.219 g/mol |
| Reported Formula |
C10H13NO2 |
| SMILES |
N(c1cc(OC)ccc1)CC(C)=O |
| SPLASH |
splash10-004i-4900000000-bf9d5f323cbf0640dce1 |
| Source of Spectrum |
ARK-2014-33-4i |
| Thin-Layer Chromatography |
Rf = 0.47 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843270 |
