| SpectraBase Spectrum ID |
B2bJYuydoJM |
| Name |
Methyl 3-(dimethylamino)-5-methyl-1H-indole-2-carboxylate |
| Appearance |
Yellow crystals |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C13H16N2O2 |
| InChI |
InChI=1S/C13H16N2O2/c1-8-5-6-10-9(7-8)12(15(2)3)11(14-10)13(16)17-4/h5-7,14H,1-4H3 |
| InChIKey |
RUQDMABMMAUTHY-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
232.283 g/mol |
| Reported Formula |
C13H16N2O2 |
| SMILES |
[nH]1c2c(c(c1C(OC)=O)N(C)C)cc(cc2)C |
| SPLASH |
splash10-0pc0-0950000000-c0873ddc8dab107059b1 |
| Source of Spectrum |
ARK-2014-44-2d |
| Thin-Layer Chromatography |
Rf = 0.51 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843236 |
