| SpectraBase Spectrum ID |
B1dorddyoWj |
| Name |
Naphazoline |
| CAS Registry Number |
835-31-4 |
| Collision Energy |
30 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
210.115698459 u |
| Formula |
C14H14N2 |
| InChI |
InChI=1S/C14H14N2/c1-2-7-13-11(4-1)5-3-6-12(13)10-14-15-8-9-16-14/h1-7H,8-10H2,(H,15,16) |
| InChIKey |
CNIIGCLFLJGOGP-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
210.280 g/mol |
| Nominal Mass |
210 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
211.123 |
| SMILES |
N1CCN=C1CC=1C=2C(C=CC1)=CC=CC2 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_611.5 |
