| SpectraBase Spectrum ID |
B0FJhwXfOsh |
| Name |
(Z)-Methyl 3-(dimethylamino)-2-[(naphthalen-2-yl)amino]acrylate |
| Appearance |
Orange solid |
| Copyright |
Copyright © 2020-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C16H18N2O2 |
| InChI |
InChI=1S/C16H18N2O2/c1-18(2)11-15(16(19)20-3)17-14-9-8-12-6-4-5-7-13(12)10-14/h4-11,17H,1-3H3/b15-11- |
| InChIKey |
FYHCWLOBPLQIII-PTNGSMBKSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
270.332 g/mol |
| Reported Formula |
C16H18N2O2 |
| SMILES |
N(\C(C(OC)=O)=C/N(C)C)c1cc2c(cc1)cccc2 |
| SPLASH |
splash10-0229-2590000000-baf39782aa0d72f95bbc |
| Source of Spectrum |
ARK-2014-36-3g |
| Thin-Layer Chromatography |
Rf = 0.80 (EtOAc) |
| Wiley ID |
1843254 |
![(Z)-Methyl 3-(dimethylamino)-2-[(naphthalen-2-yl)amino]acrylate](/api/spectrum/B0FJhwXfOsh/structure.png?h=300&w=458 "(Z)-Methyl 3-(dimethylamino)-2-[(naphthalen-2-yl)amino]acrylate")
