| SpectraBase Spectrum ID |
As5gDVItxk1 |
| Name |
Methyl 5-methyl-1H-indole-2-carboxylate |
| Appearance |
Colorless solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C11H11NO2 |
| InChI |
InChI=1S/C11H11NO2/c1-7-3-4-9-8(5-7)6-10(12-9)11(13)14-2/h3-6,12H,1-2H3 |
| InChIKey |
WMYBSXNKEVGXGX-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
189.214 g/mol |
| Reported Formula |
C11H11NO2 |
| SMILES |
[nH]1c2c(cc1C(OC)=O)cc(cc2)C |
| SPLASH |
splash10-0a4i-0900000000-516d012c86e27a4e2b68 |
| Source of Spectrum |
ARK-2014-40-1d |
| Thin-Layer Chromatography |
Rf = 0.63 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843223 |
