| SpectraBase Spectrum ID |
AirFwYKTmHs |
| Name |
Fenoprofen |
| CAS Registry Number |
31879-05-7 |
| Collision Energy |
5 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
242.094294308 u |
| Formula |
C15H14O3 |
| InChI |
InChI=1S/C15H14O3/c1-11(15(16)17)12-6-5-9-14(10-12)18-13-7-3-2-4-8-13/h2-11H,1H3,(H,16,17) |
| InChIKey |
RDJGLLICXDHJDY-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
N |
| Ionization Type |
ESI- |
| Molecular Weight |
242.274 g/mol |
| Nominal Mass |
242 u |
| Precursor Ion |
[M-H]- |
| Precursor m/z |
241.087 |
| SMILES |
OC(=O)C(C1=CC(OC2=CC=CC=C2)=CC=C1)C |
| Selected Ion Charge |
-1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-(3-phenoxyphenyl)propanoic acid |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_-_63.8 |
