| SpectraBase Spectrum ID |
AbN0PAHWyKi |
| Name |
Glutethimide |
| CAS Registry Number |
77-21-4 |
| Collision Energy |
5 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
217.110278725 u |
| Formula |
C13H15NO2 |
| InChI |
InChI=1S/C13H15NO2/c1-2-13(10-6-4-3-5-7-10)9-8-11(15)14-12(13)16/h3-7H,2,8-9H2,1H3,(H,14,15,16) |
| InChIKey |
JMBQKKAJIKAWKF-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
217.268 g/mol |
| Nominal Mass |
217 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
218.118 |
| SMILES |
N1C(CCC(C1=O)(CC)C1=CC=CC=C1)=O |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
3-ethyl-3-phenylpiperidine-2,6-dione |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_392.7 |
