| SpectraBase Spectrum ID |
AXiDSI0miGr |
| Name |
Ethyl (1R,3R,6R)-3-((tert-butyldimethylsilyl)oxy)-6-isopropyl-3-methyl-2-oxocyclohexane-1-carboxylate |
| Appearance |
Colorless oil |
| Copyright |
Copyright © 2020-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C19H36O4Si |
| InChI |
InChI=1S/C19H36O4Si/c1-10-22-17(21)15-14(13(2)3)11-12-19(7,16(15)20)23-24(8,9)18(4,5)6/h13-15H,10-12H2,1-9H3/t14-,15-,19-/m1/s1 |
| InChIKey |
PNKCXEHJPVUJED-SPYBWZPUSA-N |
| Instrument Name |
Agilent 6890 and Finnigan MAT 95 XL |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3762/bjoc.14.222 |
| Molecular Weight |
356.578 g/mol |
| Optical Rotation |
[a]D22 = -42.1 (c = 2.0, CHCl3) |
| Reported Formula |
C19H36O4Si |
| SMILES |
C1[C@@](C([C@@]([C@](C1)(C(C)C)[H])(C(OCC)=O)[H])=O)(C)O[Si](C(C)(C)C)(C)C |
| SPLASH |
splash10-00b9-6390000000-33edc8508c6c8e6c3c05 |
| Source of Spectrum |
BJO-14-SM9-23 |
| Thin-Layer Chromatography |
Rf = 0.31 (petroleum ether/EtOAc, 20:1) |
| Wiley ID |
1845725 |
