| SpectraBase Spectrum ID |
AKGhRawH42g |
| Name |
(4SR)-(??)-1-Methyl-4-phenylsulfanyl-1,2,3,4-tetrahydroquinoline |
| Appearance |
Yellow oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C16H17NS |
| InChI |
InChI=1S/C16H17NS/c1-17-12-11-16(14-9-5-6-10-15(14)17)18-13-7-3-2-4-8-13/h2-10,16H,11-12H2,1H3 |
| InChIKey |
BUSKOYOCIOHGMN-UHFFFAOYSA-N |
| Instrument Name |
Varian MAT 311A and Varian MAT 731 |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.0006.514 |
| Molecular Weight |
255.379 g/mol |
| SMILES |
c1cc2c(cc1)N(CCC2Sc1ccccc1)C |
| SPLASH |
splash10-000t-1910000000-abcf34111454d237a5b3 |
| Source of Spectrum |
ARK-2005-168-52 |
| Thin-Layer Chromatography |
Rf = 0.32 (diethyl ether/petroleum ether, 1:15) |
| Wiley ID |
1871037 |
