| SpectraBase Spectrum ID |
ABNGg6afsZq |
| Name |
Prometryne |
| CAS Registry Number |
7287-19-6 |
| Collision Energy |
45 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
241.136116806 u |
| Formula |
C10H19N5S |
| InChI |
InChI=1S/C10H19N5S/c1-6(2)11-8-13-9(12-7(3)4)15-10(14-8)16-5/h6-7H,1-5H3,(H2,11,12,13,14,15) |
| InChIKey |
AAEVYOVXGOFMJO-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
241.357 g/mol |
| Nominal Mass |
241 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
242.143 |
| SMILES |
N(C(C)C)C=1N=C(NC(C)C)N=C(N1)SC |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
6-methylsulfanyl-2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_799.8 |
