| SpectraBase Spectrum ID |
A2GQU5zE41H |
| Name |
2'-Deoxyuridine |
| Source of Sample |
TCI Chemicals India Pvt. Ltd. |
| Catalog Number |
D0060 |
| Lot Number |
JM01-IQJF |
| Accessory |
DuraSample IR #145404C7 |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
8 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
1 |
| Analog Signal 1 |
0.270187 |
| Analog Signal 2 |
0 |
| Aperture Setting |
6 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Measurement Channel |
Sample Compartment |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Background Rotations |
32 |
| Background Scans |
32 |
| Background Scans or Time |
Scans |
| Backward Peak Amplitude |
-1837 |
| Backward Peak Location |
7369 |
| Beam Splitter Setting |
KBr |
| CAS Registry Number |
951-78-0 |
| Color Properties |
White |
| Container ID |
C-009496 |
| Copyright |
Copyright © 2018-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
1 s |
| Detector Setting |
RT-DLaTGS [Internal] |
| End Frequency Limit for File |
340 |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C9H12N2O5 |
| Frequency of First Point |
3998.34 cm⁻¹ |
| Frequency of Last Point |
339.463 cm⁻¹ |
| High Folding Limit |
15800.5 |
| High Frequency Limit |
8000 cm⁻¹ |
| High Pass Filter |
0 |
| InChI |
InChI=1S/C9H12N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6+,8+/m0/s1 |
| InChIKey |
MXHRCPNRJAMMIM-SHYZEUOFSA-N |
| Instrument Name |
Bruker Tensor 27 FT-IR |
| Laser Wavenumber |
15800.5 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
10 |
| Measurement Channel |
Sample Compartment |
| Non Linearity Correction |
0 |
| Number of Points |
3795 |
| Number of Sample Scans |
32 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
-1859 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
7366 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
Mertz |
| Phase Resolution |
8 |
| Physical State |
Solid |
| Preamplifier Gain |
3 |
| Preamplifier Gain Background |
0 |
| Purity |
99% |
| Relative Humidity Interferometer |
10 % |
| Resolution |
4 |
| SKU |
D0060-1G |
| SMILES |
N1C(N([C@@]2(O[C@@]([C@](C2)(O)[H])(CO)[H])[H])\C=C/C1=O)=O |
| Sample Comments |
Sample ground at metal edge of ATR |
| Sample Rotations |
32 |
| Sample Scans or Time |
Scans |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
1 |
| Scan Time |
27.297 s |
| Scanner Temperature |
25.9 °C |
| Scanner Velocity |
10 kHz |
| Signal Gain, Background |
automatic |
| Signal Gain, Sample |
automatic |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
4000 cm⁻¹ |
| Synonyms |
1-(2-Deoxy-β-D-ribofuranosyl)uracil; Uracil deoxyriboside |
| Technique |
ATR-Neat |
| Zero Filling Factor |
4 |
