| SpectraBase Spectrum ID |
A1pxiuqlzOl |
| Name |
Phenylpropanolamine |
| CAS Registry Number |
14838-15-4 |
| Collision Energy |
45 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
151.099714042 u |
| Formula |
C9H13NO |
| InChI |
InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3 |
| InChIKey |
DLNKOYKMWOXYQA-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
151.209 g/mol |
| Nominal Mass |
151 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
152.107 |
| SMILES |
OC(C(N)C)C1=CC=CC=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-amino-1-phenylpropan-1-ol |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_659.8 |
