| SpectraBase Spectrum ID |
A1BUa7RGl3r |
| Name |
Butetamate |
| CAS Registry Number |
14007-64-8 |
| Collision Energy |
35 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
263.188529047 u |
| Formula |
C16H25NO2 |
| InChI |
InChI=1S/C16H25NO2/c1-4-15(14-10-8-7-9-11-14)16(18)19-13-12-17(5-2)6-3/h7-11,15H,4-6,12-13H2,1-3H3 |
| InChIKey |
CKWHSYRZDLWQFV-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
263.381 g/mol |
| Nominal Mass |
263 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
264.196 |
| SMILES |
C(OC(=O)C(CC)C1=CC=CC=C1)CN(CC)CC |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-(diethylamino)ethyl 2-phenylbutanoate |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_141.6 |
