| SpectraBase Spectrum ID |
9l59M3S0tbT |
| Name |
Nitrazepam |
| CAS Registry Number |
146-22-5 |
| Collision Energy |
35 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
281.080041223 u |
| Formula |
C15H11N3O3 |
| InChI |
InChI=1S/C15H11N3O3/c19-14-9-16-15(10-4-2-1-3-5-10)12-8-11(18(20)21)6-7-13(12)17-14/h1-8H,9H2,(H,17,19) |
| InChIKey |
KJONHKAYOJNZEC-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
281.271 g/mol |
| Nominal Mass |
281 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
282.087 |
| SMILES |
N1C(CN=C(C2=C1C=CC(=C2)N(=O)=O)C1=CC=CC=C1)=O |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
7-nitro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_644.6 |