| SpectraBase Spectrum ID |
9jAIHTyv0GT |
| Name |
Bis(cis-3,3,5-trimethylcyclohexyl) phthalate |
| Source of Sample |
TCI Chemicals India Pvt. Ltd. |
| Catalog Number |
P0946 |
| Lot Number |
FIGNK-EP |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
1 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
1 |
| Analog Signal 1 |
0.222559 |
| Analog Signal 2 |
0 |
| Aperture Setting |
2.5 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Backward Peak Amplitude |
2586 |
| Backward Peak Location |
28701 |
| Beam Splitter Setting |
Quartz |
| CAS Registry Number |
245652-81-7 |
| Calibration Lamp Spectrum |
Correction.0 |
| Container ID |
C-010458 |
| Copyright |
Copyright © 2017-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
15 s |
| Detector Setting |
LN-Ge Diode [Internal Pos.2] |
| End Frequency Limit for File |
9394.3 |
| External Analog Signals |
Off |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C26H38O4 |
| Frequency of First Point |
3597.77 cm⁻¹ |
| Frequency of Last Point |
-0.855506 cm⁻¹ |
| High Folding Limit |
31596.9 |
| High Frequency Limit |
30000 cm⁻¹ |
| High Pass Filter |
1 |
| InChI |
InChI=1S/C26H38O4/c1-17-11-19(15-25(3,4)13-17)29-23(27)21-9-7-8-10-22(21)24(28)30-20-12-18(2)14-26(5,6)16-20/h7-10,17-20H,11-16H2,1-6H3/t17-,18+,19+,20- |
| InChIKey |
ATHBXDPWCKSOLE-JVSBHGNQSA-N |
| Instrument Name |
Bruker MultiRAM Stand Alone FT-Raman Spectrometer |
| Laser Wavenumber |
15798.5 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
5 |
| Measurement Channel |
Raman Compartment |
| Non Linearity Correction |
0 |
| Number of Points |
7465 |
| Number of Sample Scans |
174 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
2533 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
28683 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
power spectrum |
| Phase Resolution |
1 |
| Physical State |
Solid |
| Preamplifier Gain |
0 |
| Purity |
>98.0% |
| Raman Background Corrected |
Yes |
| Raman Corrections |
Referenced to internal light source; Scattering corrected |
| Raman Laser Source |
Nd:YAG |
| Raman Scattering Corrected |
Yes |
| Relative Humidity Interferometer |
30 % |
| Resolution |
2 |
| SKU |
P0946-5G |
| SMILES |
c1c(c(ccc1)C(O[C@@]1(CC(C[C@@](C1)(C)[H])(C)C)[H])=O)C(O[C@@]1(C[C@@](CC(C1)(C)C)(C)[H])[H])=O |
| Sample Scans or Time |
Scans |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
2 |
| Scan Time |
794.638 s |
| Scanner Temperature |
25.2 °C |
| Scanner Velocity |
5 kHz |
| Signal Gain, Sample |
2 |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
5794.76 cm⁻¹ |
| Synonyms |
Phthalic acid bis(cis-3,3,5-trimethylcyclohexyl) ester |
| Technique |
FT-Raman |
| Temperature of Calibration Lamp |
2300 |
| Zero Filling Factor |
4 |
