| SpectraBase Spectrum ID |
9ZtzuYWmHNb |
| Name |
3-((tert-Butyldiphenylsilyl)oxy)propanol |
| Appearance |
Colorless oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C19H26O2Si |
| InChI |
InChI=1S/C19H26O2Si/c1-19(2,3)22(21-16-10-15-20,17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-14,20H,10,15-16H2,1-3H3 |
| InChIKey |
NZAGJZSHKTYYMN-UHFFFAOYSA-N |
| Instrument Name |
5977A GC/MSD system with a 7890B GC and 5977A mass selective detector |
| Ionization Type |
EI |
| Literature Reference DOI |
10.1002/anie.202010084 |
| Molecular Weight |
314.500 g/mol |
| SMILES |
OCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| SPLASH |
splash10-004j-1910000000-fa29412a7b5caea337ca |
| Source of Spectrum |
ACI-59-SM131-S1 |
| Thin-Layer Chromatography |
Rf =0.40 (cyclohexane/EA, 4:1) |
| Wiley ID |
1858399 |
