| SpectraBase Spectrum ID |
9U0bXFaln4 |
| Name |
1-[(4-Chlorophenyl)amino]propan-2-one |
| Appearance |
Colorless crystals |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C9H10ClNO |
| InChI |
InChI=1S/C9H10ClNO/c1-7(12)6-11-9-4-2-8(10)3-5-9/h2-5,11H,6H2,1H3 |
| InChIKey |
BXOVLBSGQHNVPM-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
183.638 g/mol |
| Reported Formula |
C9H10ClNO |
| SMILES |
N(c1ccc(Cl)cc1)CC(C)=O |
| SPLASH |
splash10-002u-1900000000-e865540375904f1ac77b |
| Source of Spectrum |
ARK-2014-33-4l |
| Thin-Layer Chromatography |
Rf = 0.49 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843272 |
![1-[(4-Chlorophenyl)amino]propan-2-one](/api/spectrum/9U0bXFaln4/structure.png?h=300&w=458 "1-[(4-Chlorophenyl)amino]propan-2-one")
