| SpectraBase Spectrum ID |
9OOGBpPX875 |
| Name |
Piperocaine |
| CAS Registry Number |
136-82-3 |
| Collision Energy |
15 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
261.172878983 u |
| Formula |
C16H23NO2 |
| InChI |
InChI=1S/C16H23NO2/c1-14-8-5-6-11-17(14)12-7-13-19-16(18)15-9-3-2-4-10-15/h2-4,9-10,14H,5-8,11-13H2,1H3 |
| InChIKey |
YQKAVWCGQQXBGW-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
261.365 g/mol |
| Nominal Mass |
261 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
262.18 |
| SMILES |
C(OC(=O)C1=CC=CC=C1)CCN1C(CCCC1)C |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
3-(2-methylpiperidin-1-yl)propyl benzoate |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_767.2 |