| SpectraBase Spectrum ID |
9MMmFrnJ8zp |
| Name |
Methyl 6-methoxy-1H-indole-2-carboxylate |
| Appearance |
Yellow solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C11H11NO3 |
| InChI |
InChI=1S/C11H11NO3/c1-14-8-4-3-7-5-10(11(13)15-2)12-9(7)6-8/h3-6,12H,1-2H3 |
| InChIKey |
OPUUCOLVBDQWEY-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
205.213 g/mol |
| Reported Formula |
C11H11NO3 |
| SMILES |
[nH]1c2c(cc1C(OC)=O)ccc(c2)OC |
| SPLASH |
splash10-0pbc-1940000000-f4e22ea0b604f30e6378 |
| Source of Spectrum |
ARK-2014-40-1b |
| Thin-Layer Chromatography |
Rf = 0.48 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843221 |
