| SpectraBase Spectrum ID |
9KKRm8coOVv |
| Name |
2-(4-Nitrophenyl)ethanol |
| Source of Sample |
TCI Chemicals India Pvt. Ltd. |
| Catalog Number |
N0569 |
| Lot Number |
LRFXL-MM |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
1 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
1 |
| Analog Signal 1 |
0.222543 |
| Analog Signal 2 |
0 |
| Aperture Setting |
2.5 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Backward Peak Amplitude |
6431 |
| Backward Peak Location |
28681 |
| Beam Splitter Setting |
Quartz |
| CAS Registry Number |
100-27-6 |
| Calibration Lamp Spectrum |
Correction.0 |
| Color Properties |
Light yellow |
| Container ID |
C-010072 |
| Copyright |
Copyright © 2017-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
15 s |
| Detector Setting |
LN-Ge Diode [Internal Pos.2] |
| End Frequency Limit for File |
9394.3 |
| External Analog Signals |
Off |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C8H9NO3 |
| Frequency of First Point |
3597.77 cm⁻¹ |
| Frequency of Last Point |
-0.855506 cm⁻¹ |
| High Folding Limit |
31596.9 |
| High Frequency Limit |
30000 cm⁻¹ |
| High Pass Filter |
1 |
| InChI |
InChI=1S/C8H9NO3/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4,10H,5-6H2 |
| InChIKey |
IKMXRUOZUUKSON-UHFFFAOYSA-N |
| Instrument Name |
Bruker MultiRAM Stand Alone FT-Raman Spectrometer |
| Laser Wavenumber |
15798.5 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
5 |
| Measurement Channel |
Raman Compartment |
| Non Linearity Correction |
0 |
| Number of Points |
7465 |
| Number of Sample Scans |
256 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
-6364 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
28699 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
power spectrum |
| Phase Resolution |
1 |
| Physical State |
Solid |
| Preamplifier Gain |
0 |
| Purity |
>98.0% |
| Raman Background Corrected |
Yes |
| Raman Corrections |
Referenced to internal light source; Scattering corrected |
| Raman Laser Source |
Nd:YAG |
| Raman Scattering Corrected |
Yes |
| Relative Humidity Interferometer |
30 % |
| Resolution |
2 |
| SKU |
N0569-5G |
| SMILES |
OCCc1ccc(cc1)N(=O)=O |
| Sample Scans or Time |
Scans |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
2 |
| Scan Time |
794.627 s |
| Scanner Temperature |
26.6 °C |
| Scanner Velocity |
5 kHz |
| Signal Gain, Sample |
2 |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
5794.76 cm⁻¹ |
| Synonyms |
4-Nitrophenethyl alcohol; 2-(4-Nitrophenyl)ethyl alcohol |
| Technique |
FT-Raman |
| Temperature of Calibration Lamp |
2300 |
| Zero Filling Factor |
4 |
