| SpectraBase Spectrum ID |
9G2nRfuLaYb |
| Name |
Thiabendazole |
| CAS Registry Number |
148-79-8 |
| Collision Energy |
5 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
201.036068411 u |
| Formula |
C10H7N3S |
| InChI |
InChI=1S/C10H7N3S/c1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9/h1-6H,(H,12,13) |
| InChIKey |
WJCNZQLZVWNLKY-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
201.247 g/mol |
| Nominal Mass |
201 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
202.043 |
| SMILES |
N1C(=NC=2C1=CC=CC2)C=1N=CSC1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
4-(1H-benzimidazol-2-yl)-1,3-thiazole |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_937.9 |
