| SpectraBase Spectrum ID |
980AWpDMLix |
| Name |
Methyl 3-(dimethylamino)-1H-benzo[g]indole-2-carboxylate |
| Appearance |
Brown solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C16H16N2O2 |
| InChI |
InChI=1S/C16H16N2O2/c1-18(2)15-12-9-8-10-6-4-5-7-11(10)13(12)17-14(15)16(19)20-3/h4-9,17H,1-3H3 |
| InChIKey |
MWCOTBNZDUTXAT-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
268.316 g/mol |
| Reported Formula |
C16H16N2O2 |
| SMILES |
[nH]1c2c(c(c1C(OC)=O)N(C)C)ccc1c2cccc1 |
| SPLASH |
splash10-0673-0590000000-48e274023289827df6f2 |
| Source of Spectrum |
ARK-2014-45-2f |
| Thin-Layer Chromatography |
Rf = 0.49 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843238 |
![Methyl 3-(dimethylamino)-1H-benzo[g]indole-2-carboxylate](/api/spectrum/980AWpDMLix/structure.png?h=300&w=458 "Methyl 3-(dimethylamino)-1H-benzo[g]indole-2-carboxylate")
