| SpectraBase Spectrum ID |
95cy90xqpAC |
| Name |
(Z)-Methyl 3-(dimethylamino)-2-[(4-methylphenyl)amino]acrylate |
| Appearance |
Blackish-red oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C13H18N2O2 |
| InChI |
InChI=1S/C13H18N2O2/c1-10-5-7-11(8-6-10)14-12(9-15(2)3)13(16)17-4/h5-9,14H,1-4H3/b12-9- |
| InChIKey |
GUSHXPDDJWYVLI-XFXZXTDPSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
234.299 g/mol |
| Reported Formula |
C13H18N2O2 |
| SMILES |
N(\C(C(OC)=O)=C/N(C)C)c1ccc(cc1)C |
| SPLASH |
splash10-00e9-5960000000-7d7f19ba9806a0c2e47d |
| Source of Spectrum |
ARK-2014-36-3d |
| Thin-Layer Chromatography |
Rf = 0.34 (EtOAc) |
| Wiley ID |
1843251 |
![(Z)-Methyl 3-(dimethylamino)-2-[(4-methylphenyl)amino]acrylate](/api/spectrum/95cy90xqpAC/structure.png?h=300&w=458 "(Z)-Methyl 3-(dimethylamino)-2-[(4-methylphenyl)amino]acrylate")
