| SpectraBase Spectrum ID |
92M1W0MeSeh |
| Name |
Methyl 2-(3,5-dimethoxyphenylamino)acetate |
| Appearance |
Yellow oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C11H15NO4 |
| InChI |
InChI=1S/C11H15NO4/c1-14-9-4-8(5-10(6-9)15-2)12-7-11(13)16-3/h4-6,12H,7H2,1-3H3 |
| InChIKey |
KVRLYQOXTCJZID-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
225.244 g/mol |
| Reported Formula |
C11H15NO4 |
| SMILES |
N(CC(OC)=O)c1cc(cc(c1)OC)OC |
| SPLASH |
splash10-016r-0930000000-5438316477ad0e1e589b |
| Source of Spectrum |
ARK-2014-31-4c |
| Thin-Layer Chromatography |
Rf = 0.40 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843264 |
