| SpectraBase Spectrum ID |
8vXwSWgxxDh |
| Name |
1-(3H-Benzo[e]indol-2-yl)ethanone |
| Appearance |
Brown solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C14H11NO |
| InChI |
InChI=1S/C14H11NO/c1-9(16)14-8-12-11-5-3-2-4-10(11)6-7-13(12)15-14/h2-8,15H,1H3 |
| InChIKey |
ASJGILPHKRXABT-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
209.248 g/mol |
| Reported Formula |
C14H11NO |
| SMILES |
[nH]1c(cc2c1ccc1ccccc21)C(C)=O |
| SPLASH |
splash10-052o-0930000000-e41c780b2f8cc096c92b |
| Source of Spectrum |
ARK-2014-42-1n |
| Thin-Layer Chromatography |
Rf = 0.36 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843230 |
![1-(3H-Benzo[e]indol-2-yl)ethanone](/api/spectrum/8vXwSWgxxDh/structure.png?h=300&w=458 "1-(3H-Benzo[e]indol-2-yl)ethanone")
