| SpectraBase Spectrum ID |
8rkm79tdyfS |
| Name |
(4SR)-(??)-1-Methyl-4-pentyl-1,2,3,4-tetrahydroquinoline |
| Appearance |
Colorless liquid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C15H23N |
| InChI |
InChI=1S/C15H23N/c1-3-4-5-8-13-11-12-16(2)15-10-7-6-9-14(13)15/h6-7,9-10,13H,3-5,8,11-12H2,1-2H3 |
| InChIKey |
HQHMKJOBFPEQFO-UHFFFAOYSA-N |
| Instrument Name |
Varian MAT 311A and Varian MAT 731 |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.0006.514 |
| Molecular Weight |
217.356 g/mol |
| SMILES |
CN1CCC(c2ccccc12)CCCCC |
| SPLASH |
splash10-0002-1940000000-05ffbedb72ae062172ab |
| Source of Spectrum |
ARK-2005-165-41 |
| Thin-Layer Chromatography |
Rf = 0.25 (diethyl ether/petroleum ether, 1:30) |
| Wiley ID |
1871031 |
