| SpectraBase Spectrum ID |
8Jx5zhia5zc |
| Name |
Trenbolone isocaproate |
| Classification |
Doping agent |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (86) |
| DEA Controlled Substance Name |
Trenbolone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
368.235144887 u |
| Formula |
C24H32O3 |
| InChI |
InChI=1S/C24H32O3/c1-15(2)4-11-23(26)27-22-10-9-21-20-7-5-16-14-17(25)6-8-18(16)19(20)12-13-24(21,22)3/h12-15,20-22H,4-11H2,1-3H3/t20-,21+,22+,24+/m1/s1 |
| InChIKey |
JLDOMYVHNPPVRM-VCHRRKICSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
368.517 g/mol |
| Nominal Mass |
368 u |
| Quality |
994 |
| Retention Index |
3253 |
| SMILES |
[C@]12([C@@]([C@](CC2)(OC(CCC(C)C)=O)[H])(C=CC=2[C@]1(CCC=1C2CCC(C1)=O)[H])C)[H] |
| SPLASH |
splash10-0udi-2490000000-de155a201ef73300c5cf |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
(1S,3aS,3bS,11aS)-11a-methyl-7-oxo-2,3,3a,3b,4,5,7,8,9,11a-decahydro-1H-cyclopenta[a]\rphenanthren-1-yl 4-methylpentanoate |
| Technique |
GC/MS |
| Wiley ID |
DD2024_013639 |
