| SpectraBase Spectrum ID |
8Jiiqa84hMW |
| Name |
Oxymetholon TMS |
| Classification |
Pharmaceutical drug derivative |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (78) |
| DEA Controlled Substance Name |
oxymetholone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
404.274671680 u |
| Formula |
C24H40O3Si |
| InChI |
InChI=1S/C24H40O3Si/c1-22-14-16(15-25)21(26)13-17(22)7-8-18-19(22)9-11-23(2)20(18)10-12-24(23,3)27-28(4,5)6/h15,17-20,25H,7-14H2,1-6H3/b16-15-/t17-,18+,19-,20-,22-,23-,24-/m0/s1 |
| InChIKey |
VJCYOVFIPOMIDP-MVWYNLPXSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
404.666 g/mol |
| Nominal Mass |
404 u |
| Quality |
996 |
| Retention Index |
2976 |
| SMILES |
O\C=C\1C[C@@]2([C@@]3([C@]([C@]4([C@@]([C@](CC4)(O[Si](C)(C)C)C)(CC3)C)[H])(CC[C@]2(CC1=O)[H])[H])[H])C |
| SPLASH |
splash10-000i-3926000000-547c4f1068894b2bd6a2 |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
(1S,3aS,3bR,5aS,8Z,9aS,9bS,11aS)-8-(hydroxymethylidene)-1,9a,11a-trimethyl-1-((trimethylsilyl)\roxy)hexadecahydro-7H-cyclopenta[a]phenanthren-7-one |
| Technique |
GC/MS |
| Wiley ID |
DD2024_027896 |
