| SpectraBase Spectrum ID |
8FUbtjEQSG0 |
| Name |
Oxandrolone |
| CAS Registry Number |
53-39-4 |
| Classification |
Pharmaceutical drug, anabolic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (76) |
| DEA Controlled Substance Name |
oxandrolone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
306.219494823 u |
| Formula |
C19H30O3 |
| InChI |
InChI=1S/C19H30O3/c1-17-11-22-16(20)10-12(17)4-5-13-14(17)6-8-18(2)15(13)7-9-19(18,3)21/h12-15,21H,4-11H2,1-3H3/t12-,13+,14-,15?,17-,18-,19-/m0/s1 |
| InChIKey |
QSLJIVKCVHQPLV-JIRIGEENSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
306.446 g/mol |
| Nominal Mass |
306 u |
| Quality |
997 |
| Retention Index |
2469 |
| SMILES |
O[C@@]1([C@@]2(C([C@]3([C@@]([C@@]4([C@@](CC3)(CC(OC4)=O)[H])C)(CC2)[H])[H])CC1)C)C |
| SPLASH |
splash10-0007-2590000000-42801008c0224f63be1b |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
17b-Hydroxy-17'-methyl-2-oxa-(5a)-androstan-3-on |
| Technique |
GC/MS |
| Wiley ID |
DD2024_030008 |
