| SpectraBase Spectrum ID |
800D0ydKpZz |
| Name |
4-Chlorophenyl chloroformate |
| Source of Sample |
TCI Chemicals India Pvt. Ltd. |
| Catalog Number |
C2545 |
| Lot Number |
UE8JG-GO |
| Accessory |
TRANS *14560FA0 |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
2 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
0 |
| Analog Signal 1 |
0.270579 |
| Analog Signal 2 |
0 |
| Aperture Setting |
6 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Measurement Channel |
Sample Compartment |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Background Scans |
32 |
| Background Scans or Time |
Scans |
| Backward Peak Amplitude |
-8483 |
| Backward Peak Location |
14458 |
| Beam Splitter Setting |
KBr |
| CAS Registry Number |
7693-45-0 |
| Color Properties |
Colorless |
| Container ID |
C-010176 |
| Copyright |
Copyright © 2018-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
0 s |
| Detector Setting |
RT-DLaTGS [Internal] |
| End Frequency Limit for File |
340 |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C7H4Cl2O2 |
| Frequency of First Point |
3999.74 cm⁻¹ |
| Frequency of Last Point |
339.942 cm⁻¹ |
| High Folding Limit |
15800.3 |
| High Frequency Limit |
8000 cm⁻¹ |
| High Pass Filter |
0 |
| InChI |
InChI=1S/C7H4Cl2O2/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4H |
| InChIKey |
RYWGPCLTVXMMHO-UHFFFAOYSA-N |
| Instrument Name |
Bruker Tensor 27 FT-IR |
| Laser Wavenumber |
15800.3 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
10 |
| Molecular Weight |
191.013 g/mol |
| Non Linearity Correction |
0 |
| Number of Points |
15181 |
| Number of Sample Scans |
32 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
-7894 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
14498 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
Mertz |
| Phase Resolution |
4 |
| Physical State |
Liquid |
| Preamplifier Gain Background |
0 |
| Purity |
>98.0% |
| Relative Humidity Interferometer |
10 % |
| Resolution |
2 |
| SKU |
C2545-5G |
| SMILES |
c1cc(ccc1OC(=O)Cl)Cl |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
1 |
| Scan Time |
50.105 s |
| Scanner Temperature |
29.6 °C |
| Scanner Velocity |
10 kHz |
| Signal Gain, Background |
automatic |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
4000 cm⁻¹ |
| Synonyms |
Chloroformic acid 4-chlorophenyl ester |
| Technique |
Neat |
| Window |
KBr Window - 1 Side |
| Zero Filling Factor |
8 |
