| SpectraBase Spectrum ID |
7ofxxSVC1gw |
| Name |
Fenticonazole |
| CAS Registry Number |
72479-26-6 |
| Collision Energy |
30 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
454.067339845 u |
| Formula |
C24H20Cl2N2OS |
| InChI |
InChI=1S/C24H20Cl2N2OS/c25-19-8-11-22(23(26)14-19)24(15-28-13-12-27-17-28)29-16-18-6-9-21(10-7-18)30-20-4-2-1-3-5-20/h1-14,17,24H,15-16H2 |
| InChIKey |
ZCJYUTQZBAIHBS-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
455.403 g/mol |
| Nominal Mass |
454 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
455.075 |
| SMILES |
C1(Cl)=C(C(OCC2=CC=C(SC3=CC=CC=C3)C=C2)CN2C=CN=C2)C=CC(Cl)=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
1-[2-(2,4-dichlorophenyl)-2-[(4-phenylsulfanylphenyl)methoxy]ethyl]imidazole |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_363.5 |