| SpectraBase Spectrum ID |
7k7wBsbFqqe |
| Name |
(S)-torosachrysone |
| Appearance |
Citrine needles |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Exact Mass |
288.099773610 u |
| Formula |
C16H16O5 |
| InChI |
InChI=1S/C16H16O5/c1-16(20)6-9-3-8-4-10(21-2)5-11(17)13(8)15(19)14(9)12(18)7-16/h3-5,17,19-20H,6-7H2,1-2H3/t16-/m0/s1 |
| InChIKey |
BFMIUBHJKFRWIV-INIZCTEOSA-N |
| Instrument Name |
VG Micromass 7070F and JEOL JMS-AX505HF |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.0002.712 |
| Optical Rotation |
[a]D12.5 = +7.8 (c = 0.5, MeOH) |
| Quality |
243 |
| SMILES |
OC=1C2=C(C=C3C[C@@](C)(CC(C3=C2O)=O)O)C=C(C1)OC |
| SPLASH |
splash10-000i-0090000000-dbcae31f5ee8bce68273 |
| Source of Spectrum |
ARK-2001-154-9 (DOI: 10.3998/ark.5550190.0002.712) |
| Thin-Layer Chromatography |
0.35 |
| Wiley ID |
1908849 |
