| SpectraBase Spectrum ID |
7ecTJ5kqrin |
| Name |
(Z)-3-[(4-Chlorophenyl)amino]-4-(dimethylamino)but-3-en-2-one |
| Appearance |
Yellow gum |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C12H15ClN2O |
| InChI |
InChI=1S/C12H15ClN2O/c1-9(16)12(8-15(2)3)14-11-6-4-10(13)5-7-11/h4-8,14H,1-3H3/b12-8- |
| InChIKey |
KNSWZVNEBLERQZ-WQLSENKSSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
238.718 g/mol |
| Reported Formula |
C12H15ClN2O |
| SMILES |
N(c1ccc(Cl)cc1)\C(C(C)=O)=C/N(C)C |
| SPLASH |
splash10-000i-0790000000-eeb736308693c812e78c |
| Source of Spectrum |
ARK-2014-38-3l |
| Thin-Layer Chromatography |
Rf = 0.26 (EtOAc) |
| Wiley ID |
1843257 |
![(Z)-3-[(4-Chlorophenyl)amino]-4-(dimethylamino)but-3-en-2-one](/api/spectrum/7ecTJ5kqrin/structure.png?h=300&w=458 "(Z)-3-[(4-Chlorophenyl)amino]-4-(dimethylamino)but-3-en-2-one")
