| SpectraBase Spectrum ID |
7dowJmDgRes |
| Name |
Chaetoviridin G |
| Appearance |
Orange amorphous solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C23H25ClO5 |
| InChI |
InChI=1S/C23H25ClO5/c1-6-12(3)8-9-14-10-15-16(11-28-14)18-17(20(25)13(4)7-2)22(27)29-23(18,5)21(26)19(15)24/h7-12,17-18H,6H2,1-5H3/b9-8+,13-7+/t12-,17+,18+,23-/m0/s1 |
| InChIKey |
GFTHCZMPYKVNIC-GETGECRZSA-N |
| Instrument Name |
Agilent-LR and Finningan Mat95 S |
| Ionization Type |
EI |
| Literature Reference DOI |
10.1021/np200110f |
| Molecular Weight |
416.901 g/mol |
| Optical Rotation |
[a]D20 = +5.5 (c = 0.002, CHCl3) |
| Reported Formula |
C23H25ClO5 |
| SMILES |
C1(=O)[C@@]2(C)OC(=O)[C@@](C(\C(C)=C\C)=O)([C@]2(C2=COC(\C=C\[C@@](C)(CC)[H])=CC2=C1Cl)[H])[H] |
| SPLASH |
splash10-067i-9027800000-28ef70468882aaa74ba6 |
| Source of Spectrum |
G4-74-SM27-11 |
| Wiley ID |
1852095 |
