| SpectraBase Spectrum ID |
7TtAiWeucDN |
| Name |
1-(Phenylamino)propan-2-one |
| Appearance |
Yellow oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C9H11NO |
| InChI |
InChI=1S/C9H11NO/c1-8(11)7-10-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3 |
| InChIKey |
VUAGYVUCYLZQKM-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
149.193 g/mol |
| Reported Formula |
C9H11NO |
| SMILES |
N(c1ccccc1)CC(C)=O |
| SPLASH |
splash10-0a6v-5900000000-3e318aeb116620128c8b |
| Source of Spectrum |
ARK-2014-32-4h |
| Thin-Layer Chromatography |
Rf = 0.53 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843269 |
