| SpectraBase Spectrum ID |
75QMRMr7dw3 |
| Name |
1-(4,6-Dimethoxy-1H-indol-2-yl)(4-fluorophenyl)methanone |
| Appearance |
Pale brown solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C17H14FNO3 |
| InChI |
InChI=1S/C17H14FNO3/c1-21-12-7-14-13(16(8-12)22-2)9-15(19-14)17(20)10-3-5-11(18)6-4-10/h3-9,19H,1-2H3 |
| InChIKey |
WMUGBEIXWZKIDA-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
299.301 g/mol |
| Reported Formula |
C17H14FNO3 |
| SMILES |
[nH]1c(cc2c1cc(cc2OC)OC)C(=O)c1ccc(cc1)F |
| SPLASH |
splash10-0002-0190000000-08d8c32c5142fbaceae0 |
| Source of Spectrum |
ARK-2014-43-1p |
| Thin-Layer Chromatography |
Rf = 0.53 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843232 |
