| SpectraBase Spectrum ID |
6ffTW7lCZkY |
| Name |
Etodroxizine |
| CAS Registry Number |
17692-34-1 |
| Collision Energy |
20 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
418.202320563 u |
| Formula |
C23H31ClN2O3 |
| InChI |
InChI=1S/C23H31ClN2O3/c24-22-8-6-21(7-9-22)23(20-4-2-1-3-5-20)26-12-10-25(11-13-26)14-16-28-18-19-29-17-15-27/h1-9,23,27H,10-19H2 |
| InChIKey |
VUFOCTSXHUWGPW-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
418.965 g/mol |
| Nominal Mass |
418 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
419.21 |
| SMILES |
OCCOCCOCCN1CCN(CC1)C(C1=CC=C(Cl)C=C1)C1=CC=CC=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-[2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethoxy]ethanol |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_348.3 |