| SpectraBase Spectrum ID |
6YUuZb9hDC2 |
| Name |
Dicyclopentyl(dimethoxy)silane |
| Source of Sample |
TCI Chemicals India Pvt. Ltd. |
| Catalog Number |
D4396 |
| Lot Number |
GTP6F-CQ |
| Accessory |
TRANS *14560FA0 |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
2 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
0 |
| Analog Signal 1 |
0.270573 |
| Analog Signal 2 |
0 |
| Aperture Setting |
6 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Measurement Channel |
Sample Compartment |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Background Scans |
32 |
| Background Scans or Time |
Scans |
| Backward Peak Amplitude |
-8187 |
| Backward Peak Location |
14479 |
| Beam Splitter Setting |
KBr |
| CAS Registry Number |
126990-35-0 |
| Color Properties |
Colorless |
| Container ID |
C-010139 |
| Copyright |
Copyright © 2018-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
0 s |
| Detector Setting |
RT-DLaTGS [Internal] |
| End Frequency Limit for File |
340 |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C12H24O2Si |
| Frequency of First Point |
3999.76 cm⁻¹ |
| Frequency of Last Point |
339.943 cm⁻¹ |
| High Folding Limit |
15800.4 |
| High Frequency Limit |
8000 cm⁻¹ |
| High Pass Filter |
0 |
| InChI |
InChI=1S/C12H24O2Si/c1-13-15(14-2,11-7-3-4-8-11)12-9-5-6-10-12/h11-12H,3-10H2,1-2H3 |
| InChIKey |
JWCYDYZLEAQGJJ-UHFFFAOYSA-N |
| Instrument Name |
Bruker Tensor 27 FT-IR |
| Laser Wavenumber |
15800.4 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
10 |
| Non Linearity Correction |
0 |
| Number of Points |
15181 |
| Number of Sample Scans |
32 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
-8144 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
14477 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
Mertz |
| Phase Resolution |
4 |
| Preamplifier Gain Background |
0 |
| Purity |
>98.0% |
| Relative Humidity Interferometer |
20 % |
| Resolution |
2 |
| SKU |
D4396-5G |
| SMILES |
C1(CCCC1)[Si](OC)(OC)C1CCCC1 |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
1 |
| Scan Time |
50.101 s |
| Scanner Temperature |
30 °C |
| Scanner Velocity |
10 kHz |
| Signal Gain, Background |
automatic |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
4000 cm⁻¹ |
| Synonyms |
Dimethoxydicyclopentylsilane |
| Technique |
Neat |
| Window |
KBr Window - 1 Side |
| Zero Filling Factor |
8 |
