| SpectraBase Spectrum ID |
6EiV6p4HeTI |
| Name |
Methyl 3-(dimethylamino)-1H-indole-2-carboxylate |
| Appearance |
Green oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C12H14N2O2 |
| InChI |
InChI=1S/C12H14N2O2/c1-14(2)11-8-6-4-5-7-9(8)13-10(11)12(15)16-3/h4-7,13H,1-3H3 |
| InChIKey |
SDWNHUFAQRRLGL-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
218.256 g/mol |
| Reported Formula |
C12H14N2O2 |
| SMILES |
[nH]1c2c(c(c1C(OC)=O)N(C)C)cccc2 |
| SPLASH |
splash10-0019-1900000000-7e975c3ec6b903ee9386 |
| Source of Spectrum |
ARK-2014-43-2a |
| Thin-Layer Chromatography |
Rf = 0.27 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843233 |
