| SpectraBase Spectrum ID |
6EZGPD52sJB |
| Name |
Norketamine |
| CAS Registry Number |
35211-10-0 |
| Collision Energy |
40 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
223.076391774 u |
| Formula |
C12H14ClNO |
| InChI |
InChI=1S/C12H14ClNO/c13-10-6-2-1-5-9(10)12(14)8-4-3-7-11(12)15/h1-2,5-6H,3-4,7-8,14H2 |
| InChIKey |
BEQZHFIKTBVCAU-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
223.703 g/mol |
| Nominal Mass |
223 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
224.084 |
| SMILES |
NC1(CCCCC1=O)C=1C(Cl)=CC=CC1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-amino-2-(2-chlorophenyl)cyclohexan-1-one |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_662.15 |
