| SpectraBase Spectrum ID |
5ivPPOWkbyH |
| Name |
Nitroso-N-phenylaniline |
| CAS Registry Number |
156-10-5 |
| Collision Energy |
35 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
198.079312949 u |
| Formula |
C12H10N2O |
| InChI |
InChI=1S/C12H10N2O/c15-14-12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h1-9,13H |
| InChIKey |
OIJHFHYPXWSVPF-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
198.225 g/mol |
| Nominal Mass |
198 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
199.087 |
| SMILES |
N(C1=CC=C(N=O)C=C1)C1=CC=CC=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
4-nitroso-N-phenylaniline |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_650.6 |
