| SpectraBase Spectrum ID |
5Yh8bmFo5su |
| Name |
Testosterone undecanoate |
| CAS Registry Number |
5949-44-0 |
| Classification |
Pharmaceutical drug, anabolic androgenic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (84) |
| DEA Controlled Substance Name |
testosterone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
456.360345403 u |
| Formula |
C30H48O3 |
| InChI |
InChI=1S/C30H48O3/c1-4-5-6-7-8-9-10-11-12-28(32)33-27-16-15-25-24-14-13-22-21-23(31)17-19-29(22,2)26(24)18-20-30(25,27)3/h21,24-27H,4-20H2,1-3H3/t24-,25-,26-,27-,29-,30-/m0/s1 |
| InChIKey |
UDSFVOAUHKGBEK-CNQKSJKFSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
456.711 g/mol |
| Nominal Mass |
456 u |
| Quality |
977 |
| Retention Index |
3546 |
| SMILES |
[C@@]12([C@]3([C@@]([C@](CC3)(OC(CCCCCCCCCC)=O)[H])(CC[C@@]1([C@@]1(C(CC2)=CC(CC1)=O)C)[H])C)[H])[H] |
| SPLASH |
splash10-05fs-2940000000-37c1a9cebccf8158870a |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
17-beta-Hydroxyandrost-4-en-3-one-undecanoate |
| Technique |
GC/MS |
| Wiley ID |
DD2024_014432 |
