| SpectraBase Spectrum ID |
5WY6aUxYTrn |
| Name |
Nisoldipine |
| CAS Registry Number |
63675-72-9 |
| Collision Energy |
35 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
388.163436495 u |
| Formula |
C20H24N2O6 |
| InChI |
InChI=1S/C20H24N2O6/c1-11(2)10-28-20(24)17-13(4)21-12(3)16(19(23)27-5)18(17)14-8-6-7-9-15(14)22(25)26/h6-9,11,18,21H,10H2,1-5H3 |
| InChIKey |
VKQFCGNPDRICFG-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
388.420 g/mol |
| Nominal Mass |
388 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
389.171 |
| SMILES |
N1C(=C(C(C(=C1C)C(OCC(C)C)=O)C=1C(N(=O)=O)=CC=CC1)C(OC)=O)C |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
3-O-methyl 5-O-(2-methylpropyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_641.6 |
