| SpectraBase Spectrum ID |
5SyzvzNvogN |
| Name |
12.beta.-Hydroxychaetoviridin C |
| Appearance |
Yellow amorphous solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C23H27ClO7 |
| InChI |
InChI=1S/C23H27ClO7/c1-10(12(3)25)6-7-14-8-15-16(9-30-14)18-17(20(27)11(2)13(4)26)22(29)31-23(18,5)21(28)19(15)24/h6-13,17-18,25-26H,1-5H3/b7-6+/t10-,11+,12-,13+,17-,18-,23+/m1/s1 |
| InChIKey |
MEPQPODJTXSHEP-HETSEVKPSA-N |
| Instrument Name |
Agilent-LR and Finningan Mat95 S |
| Ionization Type |
EI |
| Literature Reference DOI |
10.1021/np200110f |
| Molecular Weight |
450.915 g/mol |
| Optical Rotation |
[a]D20 = -125 (c = 0.002, CHCl3) |
| Reported Formula |
C23H27ClO7 |
| SMILES |
O[C@]([C@@](C([C@]1([C@]2(C3=COC(\C=C\[C@]([C@@](C)(O)[H])(C)[H])=CC3=C(C([C@]2(OC1=O)C)=O)Cl)[H])[H])=O)(C)[H])(C)[H] |
| SPLASH |
splash10-0nmi-0006900000-599537d8037a8aed4030 |
| Source of Spectrum |
G4-74-SM21-10 |
| Wiley ID |
1852094 |
