| SpectraBase Spectrum ID |
5F3wliOUTdS |
| Name |
Ethylsulfanylmethyl-methyl-phenyl-amine |
| Appearance |
Yellow liquid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C10H15NS |
| InChI |
InChI=1S/C10H15NS/c1-3-12-9-11(2)10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3 |
| InChIKey |
MQTSKOMKIZQDLU-UHFFFAOYSA-N |
| Instrument Name |
Varian MAT 311A and Varian MAT 731 |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.0006.514 |
| Molecular Weight |
181.297 g/mol |
| SMILES |
C(C)SCN(c1ccccc1)C |
| SPLASH |
splash10-00di-2900000000-4f8db50ae3d156edfd23 |
| Source of Spectrum |
ARK-2005-164-35b |
| Thin-Layer Chromatography |
Rf = 0.30 (diethyl ether/petroleum ether, 1:6) |
| Wiley ID |
1871029 |
