| SpectraBase Spectrum ID |
56LXKHjOSz7 |
| Name |
2,7-Di-tert-butylfluorene |
| Source of Sample |
Alfa Aesar, Thermo Fisher Scientific |
| Catalog Number |
H55430 |
| Lot Number |
81202185 |
| Accessory |
TRANS *14560FA0 |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
2 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
0 |
| Analog Signal 1 |
0.270574 |
| Analog Signal 2 |
0 |
| Aperture Setting |
6 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Measurement Channel |
Sample Compartment |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Background Scans |
32 |
| Background Scans or Time |
Scans |
| Backward Peak Amplitude |
-10167 |
| Backward Peak Location |
14480 |
| Beam Splitter Setting |
KBr |
| CAS Registry Number |
58775-05-6 |
| Color Properties |
White to pale brown |
| Container ID |
C-009114 |
| Copyright |
Copyright © 2018-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
0 s |
| Detector Setting |
RT-DLaTGS [Internal] |
| End Frequency Limit for File |
340 |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C21H26 |
| Frequency of First Point |
3999.54 cm⁻¹ |
| Frequency of Last Point |
339.945 cm⁻¹ |
| High Folding Limit |
15800.5 |
| High Frequency Limit |
8000 cm⁻¹ |
| High Pass Filter |
0 |
| InChI |
InChI=1S/C21H26/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18/h7-10,12-13H,11H2,1-6H3 |
| InChIKey |
DFZYPLLGAQIQTD-UHFFFAOYSA-N |
| Instrument Name |
Bruker Tensor 27 FT-IR |
| KBr Capsule ID |
K-04525 |
| Laser Wavenumber |
15800.5 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
10 |
| Molecular Weight |
278.439 g/mol |
| Non Linearity Correction |
0 |
| Number of Points |
15180 |
| Number of Sample Scans |
32 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
-10151 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
14477 |
| Peak Location 2nd Channel |
1 |
| Pellet ID |
P-04391 |
| Phase Correction Mode |
Mertz |
| Phase Resolution |
4 |
| Physical State |
Solid |
| Preamplifier Gain Background |
0 |
| Purity |
98% |
| Relative Humidity Interferometer |
0 % |
| Resolution |
2 |
| SKU |
H55430-1G |
| SMILES |
C1c2cc(ccc2-c2ccc(cc12)C(C)(C)C)C(C)(C)C |
| Sample Capsule ID |
S-04525 |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
1 |
| Scan Time |
50.056 s |
| Scanner Temperature |
29.6 °C |
| Scanner Velocity |
10 kHz |
| Signal Gain, Background |
automatic |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
4000 cm⁻¹ |
| Technique |
KBr1 |
| Zero Filling Factor |
8 |
