| SpectraBase Spectrum ID |
539LAr6p19J |
| Name |
[3-(Dimethylamino)-4,6-dimethoxy-1H-indol-2-yl](4-fluorophenyl)methanone |
| Appearance |
Yellow oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C19H19FN2O3 |
| InChI |
InChI=1S/C19H19FN2O3/c1-22(2)18-16-14(9-13(24-3)10-15(16)25-4)21-17(18)19(23)11-5-7-12(20)8-6-11/h5-10,21H,1-4H3 |
| InChIKey |
HCSUAGRVHOEJIK-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
342.370 g/mol |
| Reported Formula |
C19H19FN2O3 |
| SMILES |
[nH]1c2c(c(c1C(=O)c1ccc(cc1)F)N(C)C)c(cc(c2)OC)OC |
| SPLASH |
splash10-05fv-3930000000-3fc0add12fe5ed2e502e |
| Source of Spectrum |
ARK-2014-47-2o |
| Thin-Layer Chromatography |
Rf = 0.51 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843247 |
methanone](/api/spectrum/539LAr6p19J/structure.png?h=300&w=458 "[3-(Dimethylamino)-4,6-dimethoxy-1H-indol-2-yl](4-fluorophenyl)methanone")
