| SpectraBase Spectrum ID |
4whipcfifui |
| Name |
Ketoprofen |
| CAS Registry Number |
22071-15-4 |
| Collision Energy |
5 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
254.094294308 u |
| Formula |
C16H14O3 |
| InChI |
InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19) |
| InChIKey |
DKYWVDODHFEZIM-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
254.285 g/mol |
| Nominal Mass |
254 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
255.102 |
| SMILES |
OC(=O)C(C1=CC(=CC=C1)C(=O)C1=CC=CC=C1)C |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-(3-benzoylphenyl)propanoic acid |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_464.9 |