| SpectraBase Spectrum ID |
4V016PEXXKP |
| Name |
Tranylcypromine |
| CAS Registry Number |
155-09-9 |
| Collision Energy |
35 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
133.089149358 u |
| Formula |
C9H11N |
| InChI |
InChI=1S/C9H11N/c10-9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6,10H2 |
| InChIKey |
AELCINSCMGFISI-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
133.194 g/mol |
| Nominal Mass |
133 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
134.096 |
| SMILES |
NC1C(C1)C1=CC=CC=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-phenylcyclopropan-1-amine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_961.6 |